| Name | 2-Fluoro-4-nitrobenzoic acid |
| Synonyms | NSC 190361 SALOR-INT L446572-1EA 2-fluoro-4-nitrobenzoate 2-Fluor-4-nitrobenzoic acid 2-Fluoro-4-nitrobenzoic acid 2-Fluoro-4-nitrobenzotc acid 4-Carboxy-3-fluoronitrobenzene Benzoicacid, 2-fluoro-4-nitro- 0083512-Fluoro-4-nitrobenzoicacid 1-(4-fluorophenyl)-2-hydroxyethanone 2-FLUORO-4-NITROBENZENECARBOXYLIC ACID |
| CAS | 403-24-7 |
| EINECS | 609-823-5 |
| InChI | InChI=1/C7H4FNO4/c8-6-3-4(9(12)13)1-2-5(6)7(10)11/h1-3H,(H,10,11)/p-1 |
| InChIKey | MMWFMFZFCKADEL-UHFFFAOYSA-N |
| Molecular Formula | C7H4FNO4 |
| Molar Mass | 185.11 |
| Density | 1.568±0.06 g/cm3(Predicted) |
| Melting Point | 170 °C |
| Boling Point | 352.5±27.0 °C(Predicted) |
| Flash Point | 167°C |
| Vapor Presure | 1.41E-05mmHg at 25°C |
| Appearance | Bright yellow crystalline powder |
| Color | White to Light yellow |
| BRN | 2582091 |
| pKa | 2.37±0.13(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| MDL | MFCD00275565 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S22 - Do not breathe dust. |
| HS Code | 29163990 |
| Hazard Class | IRRITANT |